Approval: | ISO |
---|---|
IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenyl 3-methylbut-2-enoate |
IUPAC name: | 2-[(1RS)-1-methylpropyl]-4,6-dinitrophenyl 3-methylbut-2-enoate 1979 Rules: (RS)-2-sec-butyl-4,6-dinitrophenyl 3-methylcrotonate |
CAS name: | 2-(1-methylpropyl)-4,6-dinitrophenyl 3-methyl-2-butenoate |
CAS Reg. No.: | 485-31-4 |
Formula: | C15H18N2O6 |
Activity: | acaricides (dinitrophenyl crotonate) fungicides (dinitrophenyl crotonate) |
Notes: | This substance is an ester of dinoseb [88-85-7]. |
Structure: | |
Pronunciation: | bī-nǎp-a-krǐl Guide to British pronunciation |
InChIKey: | ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
InChI: | InChI=1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names