| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (RS)-2-sec-butyl-4,6-dinitrophenol |
| CAS: | 2-(1-methylpropyl)-4,6-dinitrophenol |
| Reg. No.: | 88-85-7 |
| Formula: | C10H12N2O5 |
| Activity: | herbicides (dinitrophenol herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example dinoseb acetate [2813-95-8], dinoseb-ammonium [6365-83-9], dinoseb-diolamine [53404-43-6], dinoseb-sodium [35040-03-0], dinoseb-trolamine [6420-47-9]. The 3-methyl-2-butenoate ester has its own ISO common name, binapacryl. |
| Structure: |  |
| Pronunciation: | dī-nō-sěb Guide to British pronunciation |
| InChI: | InChI=1/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |