| Status: | ISO 1750 (provisionally approved) |
|---|---|
| IUPAC: | 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid |
| CAS: | 6-amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid |
| Reg. No.: | 858956-08-8 |
| Formula: | C8H8ClN3O2 |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example aminocyclopyrachlor-methyl [858954-83-3], aminocyclopyrachlor-potassium [858956-35-1]. |
| Structure: | ![]() |
| Pronunciation: | a-mē-nō-sī-clō-pīr-a-klor Guide to British pronunciation |
| InChI: | InChI=1/C8H8ClN3O2/c9-4-5(8(13)14)11-7(3-1-2-3)12-6(4)10/h3H,1-2H2,(H,13,14)(H2,10,11,12)/f/h13H,10H2 |
A data sheet from the Compendium of Pesticide Common Names