Status: | modified ISO 1750 (provisionally approved) |
---|---|
IUPAC PIN: | methyl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
IUPAC name: | methyl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
CAS name: | methyl 6-amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylate |
CAS Reg. No.: | 858954-83-3 |
Formula: | C9H10ClN3O2 |
Activity: | herbicides (pyrimidinecarboxylic acid) |
Notes: | This substance is a derivative of aminocyclopyrachlor [858956-08-8]. |
Structure: | |
Pronunciation: | a-mē-nō-sī-clō-pīr-a-klor mē-thīl Guide to British pronunciation |
InChIKey: | MDWRNPOBHVLALB-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H10ClN3O2/c1-15-9(14)6-5(10)7(11)13-8(12-6)4-2-3-4/h4H,2-3H2,1H3,(H2,11,12,13) |
A data sheet from the Compendium of Pesticide Common Names