| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | benzo[1,2,3]thiadiazole-7-carbothioic S-acid |
| CAS: | 1,2,3-benzothiadiazole-7-carbothioic acid |
| Reg. No.: | 126448-41-7 |
| Formula: | C7H4N2OS2 |
| Activity: | fungicides (unclassified fungicides) plant activators |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example acibenzolar-S-methyl [135158-54-2]. |
| Structure: | ![]() |
| InChI: | InChI=1/C7H4N2OS2/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11)/f/h11H |
A data sheet from the Compendium of Pesticide Common Names