| Status: | modified ISO 1750 (published) |
|---|---|
| IUPAC: | S-methyl benzo[1,2,3]thiadiazole-7-carbothioate |
| CAS: | S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
| Reg. No.: | 135158-54-2 |
| Formula: | C8H6N2OS2 |
| Activity: | fungicides (unclassified fungicides) plant activators |
| Notes: | This substance is a derivative of acibenzolar [126448-41-7]. The names “benzothiadiazole” and “BTH” have been used for this substance, but have no official status. |
| Structure: | ![]() |
| InChI: | InChI=1/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 |
A data sheet from the Compendium of Pesticide Common Names