Approval: | none |
---|---|
IUPAC PIN: | 1-(3-methylphenyl)-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
IUPAC name: | 5-phenyl-1-(m-tolyl)-1H-1,2,4-triazole-3-carboxamide |
CAS name: | 1-(3-methylphenyl)-5-phenyl-1H-1,2,4-triazole-3-carboxamide |
CAS Reg. No.: | 85830-77-9 |
Formula: | C16H14N4O |
Activity: | herbicides (triazole) |
Notes: | There is no ISO common name for this substance; the name “triazofenamide” has been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | trī-āz-ō-fěn-a-mīd Guide to British pronunciation |
InChIKey: | GVROBYMTUJVBJZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C16H14N4O/c1-11-6-5-9-13(10-11)20-16(12-7-3-2-4-8-12)18-15(19-20)14(17)21/h2-10H,1H3,(H2,17,21) |
A data sheet from the Compendium of Pesticide Common Names