Approval: | ISO |
---|---|
IUPAC PIN: | 1,2,4-trichloro-5-[(4-chlorophenyl)sulfanyl]benzene |
IUPAC name: | 4-chlorophenyl 2,4,5-trichlorophenyl sulfide |
CAS name: | 1,2,4-trichloro-5-[(4-chlorophenyl)thio]benzene |
CAS Reg. No.: | 2227-13-6 |
Formula: | C12H6Cl4S |
Activity: | acaricides (diphenylsulfide) |
Notes: | The name “tetradisul” is used in Canada, and the name “diphenyl sulphide” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | tě-tra-sǔl Guide to British pronunciation |
InChIKey: | QUWSDLYBOVGOCW-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H6Cl4S/c13-7-1-3-8(4-2-7)17-12-6-10(15)9(14)5-11(12)16/h1-6H |
A data sheet from the Compendium of Pesticide Common Names