Approval: | USSR |
---|---|
IUPAC PIN: | N,N-diethylbenzamide |
IUPAC name: | N,N-diethylbenzamide |
CAS name: | N,N-diethylbenzamide |
CAS Reg. No.: | 1696-17-9 |
Formula: | C11H15NO |
Activity: | insect repellents |
Notes: | There is no ISO common name for this substance; the name “rebemide” (ребемид) was used in the former USSR. |
Structure: | |
Pronunciation: | rěb-ě-mīd Guide to British pronunciation |
InChIKey: | JLNGEXDJAQASHD-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names