Approval: | ISO |
---|---|
IUPAC PIN: | 2-(propan-2-yloxy)phenyl methylcarbamate |
IUPAC name: | 2-isopropoxyphenyl methylcarbamate |
CAS name: | 2-(1-methylethoxy)phenyl N-methylcarbamate |
CAS Reg. No.: | 114-26-1 |
Formula: | C11H15NO3 |
Activity: | acaricides (phenyl carbamate) insecticides (phenyl carbamate) |
Notes: | The name “PHC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and the name “arprocarb” was formerly approved by the British Standards Institution. |
Structure: | |
Pronunciation: | prō-pǒks-ūr Guide to British pronunciation |
InChIKey: | ISRUGXGCCGIOQO-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names