Approval: | ISO |
---|---|
IUPAC PIN: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate |
IUPAC name: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate |
CAS name: | O-(4-chloro-3-nitrophenyl) O,O-dimethyl phosphorothioate |
CAS Reg. No.: | 5826-76-6 |
Formula: | C8H9ClNO5PS |
Activity: | insecticides (phenyl organothiophosphate) |
Notes: | * The name “nichlorfos” is used in France, but the ISO common name “phosnichlor” also appears to be used. |
Structure: | |
Pronunciation: | fǒs-nǐ-klor Guide to British pronunciation |
InChIKey: | UFNIXJPHHIPRFX-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-7(9)8(5-6)10(11)12/h3-5H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names