Approval: | ISO |
---|---|
IUPAC PIN: | (3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
IUPAC name: | 3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
CAS name: | (3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
CAS Reg. No.: | 52645-53-1 |
Formula: | C21H20Cl2O3 |
Activity: | acaricides (pyrethroid) insecticides (pyrethroid) insect repellents |
Notes: | Some subsets of isomers of this substance have their own ISO common names; see biopermethrin [51877-74-8] and transpermethrin [52341-32-9]. |
Structure: | |
Pronunciation: | per-mēth-rǐn Guide to British pronunciation |
InChIKey: | RLLPVAHGXHCWKJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names