Approval: | ISO common name not required |
---|---|
IUPAC PIN: | 3-[(2S)-pyrrolidin-2-yl]pyridine |
IUPAC name: | 3-[(2S)-pyrrolidin-2-yl]pyridine |
CAS name: | 3-(2S)-2-pyrrolidinylpyridine |
CAS Reg. No.: | 494-97-3 |
Formula: | C9H12N2 |
Activity: | insecticides (alkaloid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | nor-nǐk-ō-tēn Guide to British pronunciation |
InChIKey: | MYKUKUCHPMASKF-VIFPVBQESA-N |
InChI: | InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1,3,5,7,9,11H,2,4,6H2/t9-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names