Approval: | JMAFF |
---|---|
IUPAC PIN: | 4-[(1Ξ)-2-nitroprop-1-en-1-yl]phenyl thiocyanate |
IUPAC name: | 4-[(EZ)-2-nitroprop-1-enyl]phenyl thiocyanate |
CAS name: | 4-(2-nitro-1-propen-1-yl)phenyl thiocyanate |
CAS Reg. No.: | 950-00-5 |
Formula: | C10H8N2O2S |
Activity: | fungicides (unclassified) |
Notes: | There is no ISO common name for this substance; the name “nitrostyrene” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | nī-trō-stīr-ēn Guide to British pronunciation |
InChIKey: | UHRMSMOCULMYMJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H8N2O2S/c1-8(12(13)14)6-9-2-4-10(5-3-9)15-7-11/h2-6H,1H3 |
A data sheet from the Compendium of Pesticide Common Names