Approval: | JMAFF |
---|---|
IUPAC PIN: | 2-fluoro-N-methyl-N-(naphthalen-1-yl)acetamide |
IUPAC name: | 2-fluoro-N-methyl-N-1-naphthylacetamide |
CAS name: | 2-fluoro-N-methyl-N-(1-naphthalenyl)acetamide |
CAS Reg. No.: | 5903-13-9 |
Formula: | C13H12FNO |
Activity: | acaricides (halogenated alkanoic acid) |
Notes: | There is no ISO common name for this substance; the name “MNAF” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | ěm ěn ā ěf Guide to British pronunciation |
InChIKey: | ADRPZEYTIFWCBC-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H12FNO/c1-15(13(16)9-14)12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,9H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names