Approval: | ISO |
---|---|
IUPAC PIN: | 3-methylphenyl methylcarbamate |
IUPAC name: | m-tolyl methylcarbamate |
CAS name: | 3-methylphenyl N-methylcarbamate |
CAS Reg. No.: | 1129-41-5 |
Formula: | C9H11NO2 |
Activity: | acaricides (phenyl carbamate) insecticides (phenyl carbamate) |
Notes: | The name “MTMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | mē-tǒl-karb Guide to British pronunciation |
InChIKey: | VOEYXMAFNDNNED-UHFFFAOYSA-N |
InChI: | InChI=1S/C9H11NO2/c1-7-4-3-5-8(6-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) |
A data sheet from the Compendium of Pesticide Common Names