Approval: | none |
---|---|
IUPAC PIN: | tributyl phosphorotrithioite |
IUPAC name: | tributyl phosphorotrithioite |
CAS name: | tributyl phosphorotrithioite |
CAS Reg. No.: | 150-50-5 |
Formula: | C12H27PS3 |
Activity: | plant growth regulators (defoliant) |
Notes: | There is no ISO common name for this substance; the name “merphos” has been used in the literature but it has no official approval. |
Structure: | |
Pronunciation: | mer-fǒs Guide to British pronunciation |
InChIKey: | KLAPGAOQRZTCBI-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H27PS3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h4-12H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names