Approval: | none |
---|---|
IUPAC PIN: | 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorophenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
IUPAC name: | 5-chloro-7-(4-methylpiperidino)-6-(2,4,6-trifluorophenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
CAS name: | 5-chloro-7-(4-methyl-1-piperidinyl)-6-(2,4,6-trifluorophenyl)[1,2,4]triazolo[1,5-a]pyrimidine |
CAS Reg. No.: | 214706-53-3 |
Formula: | C17H15ClF3N5 |
Activity: | fungicides (triazolopyrimidine) |
Notes: | The name “mepitriflufenpyr” has been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | mě-pǐ-trī-floo-fěn-pīr Guide to British pronunciation |
InChIKey: | ASMNSUBMNZQTTG-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H15ClF3N5/c1-9-2-4-25(5-3-9)16-14(13-11(20)6-10(19)7-12(13)21)15(18)24-17-22-8-23-26(16)17/h6-9H,2-5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names