Approval: | China |
---|---|
IUPAC PIN: | methyl (2E)-2-(2-{[(3,4-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]methyl}phenyl)-3-methoxyprop-2-enoate |
IUPAC name: | methyl (2E)-2-(2-{[(3,4-dimethyl-2-oxo-2H-chromen-7-yl)oxy]methyl}phenyl)-3-methoxyprop-2-enoate 1979 Rules: methyl (2E)-2-(2-{[(3,4-dimethyl-2-oxo-2H-chromen-7-yl)oxy]methyl}phenyl)-3-methoxyacrylate |
CAS name: | methyl (αE)-2-[[(3,4-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]methyl]-α-(methoxymethylene)benzeneacetate |
CAS Reg. No.: | 850881-30-0 |
Formula: | C23H22O6 |
Activity: | fungicides (methoxyacrylate) |
Notes: | There is no ISO common name for this substance; the name “jiaxiangjunzhi” (甲香菌酯) is approved in China. The name “coumethoxystrobin” has been used in the literature, but it has no officical status. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | AOZYNCYSQLZALW-DEDYPNTBSA-N |
InChI: | InChI=1S/C23H22O6/c1-14-15(2)22(24)29-21-11-17(9-10-18(14)21)28-12-16-7-5-6-8-19(16)20(13-26-3)23(25)27-4/h5-11,13H,12H2,1-4H3/b20-13+ |
A data sheet from the Compendium of Pesticide Common Names