Approval: | China |
---|---|
IUPAC PIN: | N-{(2Ξ)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]imidazolidin-2-ylidene}nitramide |
IUPAC name: | (EZ)-1-[(2-chlorothiazol-5-yl)methyl]-N-nitroimidazolidin-2-imine |
CAS name: | 1-[(2-chloro-5-thiazolyl)methyl]-N-nitro-2-imidazolidinimine |
CAS Reg. No.: | 105843-36-5 |
Formula: | C7H8ClN5O2S |
Activity: | insecticides (nitroguanidine) |
Notes: | There is no ISO common name for this substance; the name “imidaclothiz” (氯噻啉) is approved in China. |
Structure: | |
Pronunciation: | ǐm-ǐd-a-klō-thǐz Guide to British pronunciation |
InChIKey: | OWRSHPAYDYCHSJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H8ClN5O2S/c8-6-10-3-5(16-6)4-12-2-1-9-7(12)11-13(14)15/h3H,1-2,4H2,(H,9,11) |
A data sheet from the Compendium of Pesticide Common Names