Approval: | ISO common name not required |
---|---|
IUPAC PIN: | fluoroacetic acid |
IUPAC name: | fluoroacetic acid |
CAS name: | 2-fluoroacetic acid |
CAS Reg. No.: | 144-49-0 |
Formula: | C2H3FO2 |
Activity: | rodenticides (halogenated alkanoic acid) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The sodium salt, sodium fluoroacetate [62-74-8], is also considered not to require a common name. |
Structure: | |
Pronunciation: | floo-a-rō-a-sē-tǐk ǎs-ǐd Guide to British pronunciation |
InChIKey: | QEWYKACRFQMRMB-UHFFFAOYSA-N |
InChI: | InChI=1S/C2H3FO2/c3-1-2(4)5/h1H2,(H,4,5) |
A data sheet from the Compendium of Pesticide Common Names