Approval: | China |
---|---|
IUPAC PIN: | 2-chloro-N-(2-ethylphenyl)-N-propan-2-ylacetamide |
IUPAC name: | 2-chloro-2′-ethyl-N-isopropylacetanilide |
CAS name: | 2-chloro-N-(2-ethylphenyl)-N-(1-methylethyl)acetamide |
CAS Reg. No.: | |
Formula: | C13H18ClNO |
Activity: | herbicides (chloroacetamide) |
Notes: | There is no ISO common name for this substance; the name “ethaprochlor” (杀草胺) is approved in China. |
Structure: | |
Pronunciation: | ě-thǎp-rō-klor Guide to British pronunciation |
InChIKey: | CIGFIQQHUGBWEL-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H18ClNO/c1-4-11-7-5-6-8-12(11)15(10(2)3)13(16)9-14/h5-8,10H,4,9H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names