Approval: | ISO common name not required - diethyltoluamide (ISO); DEET (ANSI/ESA) |
---|---|
IUPAC PIN: | N,N-diethyl-3-methylbenzamide |
IUPAC name: | N,N-diethyl-3-methylbenzamide 1979 Rules: N,N-diethyl-m-toluamide |
CAS name: | N,N-diethyl-3-methylbenzamide |
CAS Reg. No.: | 134-62-3 |
Formula: | C12H17NO |
Activity: | insect repellents |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “deet” is approved by the American National Standards Institute and the Entomological Society of America. |
Structure: | |
Pronunciation: | dī-ē-thīl-tǒl-ū-a-mīd Guide to British pronunciation |
InChIKey: | MMOXZBCLCQITDF-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names