Approval: | JMAFF |
---|---|
IUPAC PIN: | rac-(2R)-1,2-dibromo-3-chloropropane |
IUPAC name: | (RS)-1,2-dibromo-3-chloropropane |
CAS name: | 1,2-dibromo-3-chloropropane |
CAS Reg. No.: | 96-12-8 |
Formula: | C3H5Br2Cl |
Activity: | fungicides (fumigant) nematicides (alkyl halide; fumigant) |
Notes: | There is no ISO common name for this substance; the name “DBCP” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
Structure: | |
Pronunciation: | dē bē sē pē Guide to British pronunciation |
InChIKey: | WBEJYOJJBDISQU-UHFFFAOYSA-N |
InChI: | InChI=1S/C3H5Br2Cl/c4-1-3(5)2-6/h3H,1-2H2 |
A data sheet from the Compendium of Pesticide Common Names