Approval: | China |
---|---|
IUPAC PIN: | 2-chloro-N-[(4-chlorophenyl)carbamoyl]benzamide |
IUPAC name: | 2-chloro-N-[(4-chlorophenyl)carbamoyl]benzamide 1979 Rules: 1-(2-chlorobenzoyl)-3-(4-chlorophenyl)urea |
CAS name: | 2-chloro-N-[[(4-chlorophenyl)amino]carbonyl]benzamide |
CAS Reg. No.: | 57160-47-1 |
Formula: | C14H10Cl2N2O2 |
Activity: | insecticides (benzoylurea) |
Notes: | There is no ISO common name for this substance; the name “chlorbenzuron” (灭幼脲) is approved in China. |
Structure: | |
Pronunciation: | klor-běnz-ūr-ǒn Guide to British pronunciation |
InChIKey: | YPSCQJTUAKNUNF-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H10Cl2N2O2/c15-9-5-7-10(8-6-9)17-14(20)18-13(19)11-3-1-2-4-12(11)16/h1-8H,(H2,17,18,19,20) |
A data sheet from the Compendium of Pesticide Common Names