Approval: | WSSA |
---|---|
IUPAC PIN: | 2-chloro-N,N-diethylacetamide |
IUPAC name: | 2-chloro-N,N-diethylacetamide |
CAS name: | 2-chloro-N,N-diethylacetamide |
CAS Reg. No.: | 2315-36-8 |
Formula: | C6H12ClNO |
Activity: | herbicides (chloroacetamide) |
Notes: | There is no ISO common name for this substance; the name “CDEA” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | sē dē ē ā Guide to British pronunciation |
InChIKey: | CQQUWTMMFMJEFE-UHFFFAOYSA-N |
InChI: | InChI=1S/C6H12ClNO/c1-3-8(4-2)6(9)5-7/h3-5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names