Approval: | ISO |
---|---|
IUPAC name: | (E)-L-2-[2-(2-aminoethoxy)vinyl]glycine or (2S,3E)-2-amino-4-(2-aminoethoxy)but-3-enoic acid |
CAS name: | (2S,3E)-2-amino-4-(2-aminoethoxy)-3-butenoic acid |
CAS Reg. No.: | 49669-74-1 |
Formula: | C6H12N2O3 |
Activity: | plant growth regulators (ethylene inhibitor) |
Notes: | Derivatives include aviglycine hydrochloride [55720-26-8]. The name “AVG” has been used in the literature, but it has no official approval. |
Structure: | |
Pronunciation: | ǎv-ǐ-glī-sēn Guide to British pronunciation |
InChIKey: | USGUVNUTPWXWBA-JRIXXDKMSA-N |
InChI: | InChI=1S/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names