Approval: | China |
---|---|
IUPAC PIN: | diammonium N,N′-ethane-1,2-diyldicarbamodithioate |
IUPAC name: | diammonium ethylenebis(dithiocarbamate) |
CAS name: | diammonium N,N′-1,2-ethanediylbis(carbamodithioate) |
CAS Reg. No.: | 3566-10-7 |
Formula: | C4H14N4S4 |
Activity: | fungicides (alkylenebis(dithiocarbamate)) |
Notes: | There is no ISO common name for this substance; the name “amobam” (代森铵) is approved in China. |
Structure: | |
Pronunciation: | a-mō-bǎm Guide to British pronunciation |
InChIKey: | FROZIYRKKUFAOC-UHFFFAOYSA-N |
InChI: | InChI=1S/C4H8N2S4.2H3N/c7-3(8)5-1-2-6-4(9)10;;/h1-2H2,(H2,5,7,8)(H2,6,9,10);2*1H3 |
A data sheet from the Compendium of Pesticide Common Names