| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 3,4-xylyl methylcarbamate |
| CAS: | 3,4-dimethylphenyl N-methylcarbamate |
| Reg. No.: | 2425-10-7 |
| Formula: | C10H13NO2 |
| Activity: | insecticides (phenyl methylcarbamate insecticides) |
| Notes: | The name “MPMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | zī-līl-karb Guide to British pronunciation |
| InChIKey: | WCJYTPVNMWIZCG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13NO2/c1-7-4-5-9(6-8(7)2)13-10(12)11-3/h4-6H,1-3H3,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names