| Status: | WSSA |
|---|---|
| IUPAC: | 2-chloro-N-isopropylacet-2′,3′-xylidide |
| CAS: | 2-chloro-N-(2,3-dimethylphenyl)-N-(1-methylethyl)acetamide |
| Reg. No.: | 63114-77-2 |
| Formula: | C13H18ClNO |
| Activity: | herbicides (chloroacetanilide herbicides) |
| Notes: | There is no ISO common name for this substance; the name “xylachlor” is approved by the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | zī-la-klor Guide to British pronunciation |
| InChI: | InChI=1/C13H18ClNO/c1-9(2)15(13(16)8-14)12-7-5-6-10(3)11(12)4/h5-7,9H,8H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names