| Status: | JMAFF |
|---|---|
| IUPAC: | 3,5-xylyl methylcarbamate |
| CAS: | 3,5-dimethylphenyl methylcarbamate |
| Reg. No.: | 2655-14-3 |
| Formula: | C10H13NO2 |
| Activity: | insecticides (phenyl methylcarbamate insecticides) |
| Notes: | There is no ISO common name for this substance; the name “XMC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | ěks ěm sē Guide to British pronunciation |
| InChI: | InChI=1/C10H13NO2/c1-7-4-8(2)6-9(5-7)13-10(12)11-3/h4-6H,1-3H3,(H,11,12)/f/h11H |