| Status: | China |
|---|---|
| IUPAC: | 3′-chloro-2-methoxy-N-[(3RS)-tetrahydro-2-oxofuran-3-yl]acet-2′,6′-xylidide |
| CAS: | N-(3-chloro-2,6-dimethylphenyl)-2-methoxy-N-(tetrahydro-2-oxo-3-furanyl)acetamide |
| Reg. No.: | 67932-85-8 |
| Formula: | C15H18ClNO4 |
| Activity: | fungicides (anilide fungicides) |
| Notes: | There is no ISO common name for this substance; the name “vangard” (抑霉胺) is approved in China, even though Vangard is (or was) a registered trade mark in many countries for this substance and for cyprodinil. The names “cloxylacon” and “clozylacon” have been used in the literature, but they have no official status. |
| Structure: | ![]() |
| Pronunciation: | vǎn-gard Guide to British pronunciation |
| InChIKey: | FHZMAAGOSXDIBJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H18ClNO4/c1-9-4-5-11(16)10(2)14(9)17(13(18)8-20-3)12-6-7-21-15(12)19/h4-5,12H,6-8H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names