| Status: | China |
|---|---|
| IUPAC: | 2-isovaleryl-1,3-indandione or 2-(3-methylbutanoyl)-1H-indene-1,3(2H)-dione |
| CAS: | 2-(3-methyl-1-oxobutyl)-1H-indene-1,3(2H)-dione |
| Reg. No.: | 83-28-3 |
| Formula: | C14H14O3 |
| Activity: | rodenticides (indandione rodenticides) |
| Notes: | There is no ISO common name for this substance; the name “valone” (杀鼠酮) is approved in China, even though Valone is (or was) a registered trade mark in many countries. |
| Structure: |  |
| Pronunciation: | vāl-ōn Guide to British pronunciation |
| InChIKey: | PVWMAOPFDINGAY-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H14O3/c1-8(2)7-11(15)12-13(16)9-5-3-4-6-10(9)14(12)17/h3-6,8,12H,7H2,1-2H3 |