Status: | China |
---|---|
IUPAC PIN: | 2-(3-methylbutanoyl)-1H-indene-1,3(2H)-dione |
IUPAC name: | 2-(3-methylbutanoyl)indane-1,3-dione 1979 Rules: 2-isovalerylindan-1,3-dione |
CAS name: | 2-(3-methyl-1-oxobutyl)-1H-indene-1,3(2H)-dione |
CAS Reg. No.: | 83-28-3 |
Formula: | C14H14O3 |
Activity: | rodenticides (indandione) |
Notes: | There is no ISO common name for this substance; the name “valone” (杀鼠酮) is approved in China, even though Valone is (or was) a registered trade mark in many countries. |
Structure: | |
Pronunciation: | vāl-ōn Guide to British pronunciation |
InChIKey: | PVWMAOPFDINGAY-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H14O3/c1-8(2)7-11(15)12-13(16)9-5-3-4-6-10(9)14(12)17/h3-6,8,12H,7H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names