| Status: | none |
|---|---|
| IUPAC: | mixture of isopropyl (E,E)-2,4-dimethylhepta-2,4-dienoate and isopropyl (E)-2-methylpent-2-enoate |
| CAS: | 1-methylethyl (2E,4E)-2,4-dimethyl-2,4-heptadienoate mixture with 1-methylethyl (2E)-2-methyl-2-pentenoate |
| Reg. No.: | |
| Formula: | C12H20O2 + C9H16O2 |
| Activity: | insect attractants (coleopteran attractants) |
| Notes: | There is no ISO common name for this substance; the name “trunc-call” has been used in the literature but has no official status. This substance is named after the insect from which it was isolated, Prostephanus truncatus (Horn) (Bostrichidae, Coleoptera). |
| Structure: |  |
| Pronunciation: | trǔnk-korl Guide to British pronunciation |
| InChI: | 1-methylethyl (2E,4E)-2,4-dimethyl-2,4-heptadienoate InChI=1/C12H20O2/c1-6-7-10(4)8-11(5)12(13)14-9(2)3/h7-9H,6H2,1-5H3/b10-7+,11-8+ 1-methylethyl (2E)-2-methyl-2-pentenoate InChI=1/C9H16O2/c1-5-6-8(4)9(10)11-7(2)3/h6-7H,5H2,1-4H3/b8-6+ |