Status: | ISO 1750 (approved) |
---|---|
IUPAC PIN: | methyl (Ξ)-N′-(4-chlorophenyl)-N,N-dimethylcarbamimidate |
IUPAC name: | (EZ)-3-(4-chlorophenyl)-1,1,2-trimethylisourea |
CAS name: | methyl N′-(4-chlorophenyl)-N,N-dimethylcarbamimidate |
CAS Reg. No.: | 3050-27-9 |
Formula: | C10H13ClN2O |
Activity: | herbicides (urea) |
Notes: | The name “trimeturon” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | trī-mět-ūr-ǒn Guide to British pronunciation |
InChIKey: | MYURAHUSYDVWQA-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H13ClN2O/c1-13(2)10(14-3)12-9-6-4-8(11)5-7-9/h4-7H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names