| Status: | BSI |
|---|---|
| IUPAC: | (EZ)-3-(4-chlorophenyl)-1,1,2-trimethylisourea |
| CAS: | methyl N′-(4-chlorophenyl)-N,N-dimethylcarbamimidate |
| Reg. No.: | 3050-27-9 |
| Formula: | C10H13ClN2O |
| Activity: | herbicides (unclassified herbicides) |
| Notes: | There is no ISO common name for this substance; the name “trimeturon” is approved by the British Standards Institution and the Weed Science Society of America. |
| Structure: | ![]() |
| Pronunciation: | trī-mět-ūr-ǒn Guide to British pronunciation |
| InChIKey: | MYURAHUSYDVWQA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13ClN2O/c1-13(2)10(14-3)12-9-6-4-8(11)5-7-9/h4-7H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names