| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | a reaction product comprising from 3.5 to 5 parts by mass of 3,4,5-trimethylphenyl methylcarbamate to 1 part by mass of 2,3,5-trimethylphenyl methylcarbamate |
| CAS: | 2,3,5(or 3,4,5)-trimethylphenyl methylcarbamate |
| Reg. No.: | 12407-86-2 |
| Formula: | C11H15NO2 |
| Activity: | bird repellents insecticides (phenyl methylcarbamate insecticides) mammal repellents molluscicides |
| Notes: | |
| Structure: | ![]() |
| Pronunciation: | trī-měth-a-karb Guide to British pronunciation |
| InChI: | 2,3,5-trimethylphenyl methylcarbamate InChI=1/C11H15NO2/c1-7-5-8(2)9(3)10(6-7)14-11(13)12-4/h5-6H,1-4H3,(H,12,13)/f/h12H 3,4,5-trimethylphenyl methylcarbamate InChI=1/C11H15NO2/c1-7-5-10(14-11(13)12-4)6-8(2)9(7)3/h5-6H,1-4H3,(H,12,13)/f/h12H |
A data sheet from the Compendium of Pesticide Common Names