| Status: |
ISO 1750 (published) |
| IUPAC: |
reaction mixture of 4-alkyl-2,6-dimethylmorpholines, where “alkyl” is mixture of C11–C14 homologues of which 60–70% is tridecyl |
| CAS: |
tridemorph |
| Reg. No.: |
81412-43-3 |
| Formula: |
C19H39NO (major component) |
| Activity: |
fungicides (morpholine fungicides) |
| Notes: |
The name “tridemorph” was originally approved for the single isomer 2,6-dimethyl-4-tridecylmorpholine [24602-86-6]. After the common name was approved, it became known that the active ingredient in the commercial product was a reaction mixture, and the definition was changed in ISO 1750-1981/Amd. 1-1982 Pesticides and other agrochemicals – Common names, Amendment 1. |
| Structure: |
 |
| Pronunciation: |
trī-dē-morf Guide to British pronunciation |
| InChI: |
InChI=1/C19H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-20-16-18(2)21-19(3)17-20/h18-19H,4-17H2,1-3H3 (major component) |