Status: | China |
---|---|
IUPAC PIN: | 4,4-dimethylmorpholin-4-ium chloride |
IUPAC name: | 4,4-dimethylmorpholin-4-ium chloride |
CAS name: | 4,4-dimethylmorpholinium chloride |
CAS Reg. No.: | 23165-19-7 |
Formula: | C6H14ClNO |
Activity: | plant growth regulators (growth inhibitor) |
Notes: | There is no ISO common name for this substance; the name “tiaojiean” (调节安) is approved in China. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | RBIPMCDRANHGQI-UHFFFAOYSA-M |
InChI: | InChI=1S/C6H14NO.ClH/c1-7(2)3-5-8-6-4-7;/h3-6H2,1-2H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names