| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | tetramethylthiuram disulfide or bis(dimethylthiocarbamoyl) disulfide |
| CAS: | tetramethylthioperoxydicarbonic diamide ([[(CH3)2N]C(S)]2S2) |
| Reg. No.: | 137-26-8 |
| Formula: | C6H12N2S4 |
| Activity: | bird repellents fungicides (dithiocarbamate fungicides) |
| Notes: | The name “thiuram” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries, and the name “TMTD” (ТМТД) was used in the former USSR. |
| Structure: |  |
| Pronunciation: | thī-rǎm Guide to British pronunciation |
| InChIKey: | KUAZQDVKQLNFPE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3 |