| Status: | China |
|---|---|
| IUPAC: | hydrazinecarbothioamide or N-aminothiourea |
| CAS: | hydrazinecarbothioamide |
| Reg. No.: | 79-19-6 |
| Formula: | CH5N3S |
| Activity: | rodenticides (thiourea rodenticides) |
| Notes: | There is no ISO common name for this substance; the old chemical name “thiosemicarbazide” (灭鼠特) is approved as a common name in China. |
| Structure: | ![]() |
| Pronunciation: | thī-ō-sěm-ē-karb-a-zīd Guide to British pronunciation |
| InChIKey: | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
| InChI: | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
A data sheet from the Compendium of Pesticide Common Names