Status: | China |
---|---|
IUPAC PIN: | (1Ξ)-1-(4-chloro-3-fluorophenyl)-N-[(2-methyl-[1,1′-biphenyl]-3-yl)methoxy]-2-(methylsulfanyl)ethan-1-imine |
IUPAC name: | 1-(4-chloro-3-fluorophenyl)-2-(methylthio)ethanone (EZ)-O-[(2-methylbiphenyl-3-yl)methyl]oxime |
CAS name: | 1-(4-chloro-3-fluorophenyl)-2-(methylthio)ethanone O-[(2-methyl-[1,1′-biphenyl]-3-yl)methyl]oxime |
CAS Reg. No.: | |
Formula: | C23H21ClFNOS |
Activity: | insecticides (pyrethroid oxime) |
Notes: | There is no ISO common name for this substance; the name “thiofluoximate” is approved in China. |
Structure: | |
Pronunciation: | thī-ō-floo-ǒks-ǐ-māt Guide to British pronunciation |
InChIKey: | ULERLVZDMYNWNA-UHFFFAOYSA-N |
InChI: | InChI=1S/C23H21ClFNOS/c1-16-19(9-6-10-20(16)17-7-4-3-5-8-17)14-27-26-23(15-28-2)18-11-12-21(24)22(25)13-18/h3-13H,14-15H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names