Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | dimethyl (1Ξ,1′Ξ)-N,N′-{sulfanediylbis[(methylcarbamoyl)oxy]}diethanimidothioate |
IUPAC name: | dimethyl (1EZ,1′EZ)-N,N′-{sulfanediylbis[(methylcarbamoyl)oxy]}di(thioacetimidate) 1979 Rules: dimethyl (1EZ,1′EZ)-N,N′-{thiobis[(methylcarbamoyl)oxy]}di(thioacetimidate) |
CAS name: | dimethyl N,N′-[thiobis[(methylimino)carbonyloxy]]bis[ethanimidothioate] |
CAS Reg. No.: | 59669-26-0 |
Formula: | C10H18N4O4S3 |
Activity: | insecticides (oxime carbamate) molluscicides |
Notes: | The names “dicarbasulf” and “dicarbosulf” have been used in the literature, but they have no official status. |
Structure: | |
Pronunciation: | thī-ō-dī-karb Guide to British pronunciation |
InChIKey: | XDOTVMNBCQVZKG-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H18N4O4S3/c1-7(19-5)11-17-9(15)13(3)21-14(4)10(16)18-12-8(2)20-6/h1-6H3 |
A data sheet from the Compendium of Pesticide Common Names