| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | S-4-chlorobenzyl diethyl(thiocarbamate) |
| CAS: | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate |
| Reg. No.: | 28249-77-6 |
| Formula: | C12H16ClNOS |
| Activity: | herbicides (thiocarbamate herbicides) |
| Notes: | The name “benthiocarb” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | ![]() |
| Pronunciation: | thī-ō-běn-karb Guide to British pronunciation |
| InChIKey: | QHTQREMOGMZHJV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names