| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | 2-(thiazol-4-yl)benzimidazole or 2-(1,3-thiazol-4-yl)benzimidazole |
| CAS: | 2-(4-thiazolyl)-1H-benzimidazole |
| Reg. No.: | 148-79-8 |
| Formula: | C10H7N3S |
| Activity: | fungicides (benzimidazole fungicides; thiazole fungicides) |
| Notes: | The name “tiabendazole” is approved by the World Health Organization. The name “TBZ” has been used for this substance, but has no official status. |
| Structure: |  |
| Pronunciation: | thī-a-běn-da-zōl Guide to British pronunciation |
| InChI: | InChI=1/C10H7N3S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9/h1-6H,(H,12,13)/f/h12H |