| Status: | ISO 1750 (published) |
|---|---|
| IUPAC: | (5RS)-2-{(EZ)-1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one |
| CAS: | 2-[1-[[[(2E)-3-chloro-2-propen-1-yl]oxy]imino]propyl]-3-hydroxy-5-(tetrahydro-2H-pyran-4-yl)-2-cyclohexen-1-one |
| Reg. No.: | 149979-41-9 |
| Formula: | C17H24ClNO4 |
| Activity: | herbicides (cyclohexene oxime herbicides) |
| Notes: | The name “tepraloxydim” (吡喃草酮) is approved in China, but is incorrectly spelled “teproloxydim” in GB 4839-2009 Chinese common names for pesticides. |
| Structure: | ![]() |
| Pronunciation: | tě-prǎl-ǒk-sē-dǐm Guide to British pronunciation |
| InChIKey: | IOYNQIMAUDJVEI-ZFNPBRLTSA-N |
| InChI: | InChI=1S/C17H24ClNO4/c1-2-14(19-23-7-3-6-18)17-15(20)10-13(11-16(17)21)12-4-8-22-9-5-12/h3,6,12-13,20H,2,4-5,7-11H2,1H3/b6-3+,19-14? |
A data sheet from the Compendium of Pesticide Common Names