| Status: | BSI |
|---|---|
| IUPAC: | N′,N′,N‴,N‴-tetramethyl-N,N″-ethylenedi(thiuram disulfide) or N,N,N′,N′-tetramethyl-4,9-dithioxo-2,3,10,11-tetrathia-5,8-diazadodecanedithioamide |
| CAS: | N,N,N′,N′-tetramethyl-4,9-dithioxo-2,3,10,11-tetrathia-5,8-diazadodecanedithioamide |
| Reg. No.: | 5836-23-7 |
| Formula: | C10H18N4S8 |
| Activity: | fungicides (dithiocarbamate fungicides) |
| Notes: | There is no ISO common name for this substance; the name “tecoram” is approved by the British Standards Institution. |
| Structure: | ![]() |
| Pronunciation: | těk-or-ǎm Guide to British pronunciation |
| InChI: | InChI=1/C10H18N4S8/c1-13(2)9(17)21-19-7(15)11-5-6-12-8(16)20-22-10(18)14(3)4/h5-6H2,1-4H3,(H,11,15)(H,12,16)/f/h11-12H |
A data sheet from the Compendium of Pesticide Common Names