Status: | ISO 1750 (published) |
---|---|
IUPAC PIN: | 1,1′-(2,2-dichloroethane-1,1-diyl)bis(4-chlorobenzene) |
IUPAC name: | 1,1-dichloro-2,2-bis(4-chlorophenyl)ethane |
CAS name: | 1,1′-(2,2-dichloroethylidene)bis[4-chlorobenzene] |
CAS Reg. No.: | 72-54-8 |
Formula: | C14H10Cl4 |
Activity: | insecticides (organochlorine) |
Notes: | The name “DDD” has been used in the literature, but it has no official status. |
Structure: | |
Pronunciation: | tē dē ē Guide to British pronunciation |
InChIKey: | AHJKRLASYNVKDZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
A data sheet from the Compendium of Pesticide Common Names