| Status: |
ANSI |
| IUPAC: |
methyl 3,4-dichlorocarbanilate |
| CAS: |
methyl (3,4-dichlorophenyl)carbamate |
| Reg. No.: |
1918-18-9 |
| Formula: |
C8H7Cl2NO2 |
| Activity: |
herbicides (carbanilate herbicides) |
| Notes: |
There is no ISO common name for this substance; the name “swep” is approved by the American National Standards Institute and the Weed Science Society of America, and the name “MCC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |
 |
| Pronunciation: |
swěp Guide to British pronunciation |
| InChI: |
InChI=1/C8H7Cl2NO2/c1-13-8(12)11-5-2-3-6(9)7(10)4-5/h2-4H,1H3,(H,11,12)/f/h11H |