Status: | China |
---|---|
IUPAC PIN: | rac-(1Ξ,2R)-1-(4-chlorophenyl)-2-(methylsulfanyl)-N-[(3-phenoxyphenyl)methoxy]propan-1-imine |
IUPAC name: | (RS)-[1-(4-chlorophenyl)-2-(methylthio)-1-propanone] (EZ)-O-(3-phenoxybenzyl)oxime |
CAS name: | 1-(4-chlorophenyl)-2-(methylthio)-1-propanone O-[(3-phenoxyphenyl)methyl]oxime |
CAS Reg. No.: | |
Formula: | C23H22ClNO2S |
Activity: | insecticides (pyrethroid oxime) |
Notes: | There is no ISO common name for this substance; the name “sulfoxime” (硫肟醚) is approved in China. |
Structure: | |
Pronunciation: | sǔl-fǒks-ēm Guide to British pronunciation |
InChIKey: | LFSXYCYIVKDFLF-UHFFFAOYSA-N |
InChI: | InChI=1S/C23H22ClNO2S/c1-17(28-2)23(19-11-13-20(24)14-12-19)25-26-16-18-7-6-10-22(15-18)27-21-8-4-3-5-9-21/h3-15,17H,16H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names