| Status: | ESA |
|---|---|
| IUPAC: | (RS)-2-(1,3-benzodioxol-5-yl)-1-methylethyl octyl sulfoxide or (RS)-1-methyl-2-(3,4-methylenedioxyphenyl)ethyl octyl sulfoxide |
| CAS: | 5-[2-(octylsulfinyl)propyl]-1,3-benzodioxole |
| Reg. No.: | 120-62-7 |
| Formula: | C18H28O3S |
| Activity: | synergists |
| Notes: | There is no ISO common name for this substance; the name “sulfoxide” is approved by the Entomological Society of America. |
| Structure: |  |
| InChI: | sp3 tetrahedral stereochemistry not specified InChI=1/C18H28O3S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17/h9-10,13,15H,3-8,11-12,14H2,1-2H3 all combinations of (R)- and (S)-stereoisomers InChI=1/C18H28O3S/c1-3-4-5-6-7-8-11-22(19)15(2)12-16-9-10-17-18(13-16)21-14-20-17/h9-10,13,15H,3-8,11-12,14H2,1-2H3/t15?,22? |